* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH676551 |
| English Synonyms: | FCHGROUP FCH676551 |
| MDL Number.: | MFCD17428243 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | CC(C)N(CC/C(=N/O)/N)C(=O)c1cc[nH]n1 |
| InChi: | InChI=1S/C10H17N5O2/c1-7(2)15(6-4-9(11)14-17)10(16)8-3-5-12-13-8/h3,5,7,17H,4,6H2,1-2H3,(H2,11,14)(H,12,13) |
| InChiKey: | InChIKey=XQUFOVDRNIFGNG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.