* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH676554 |
English Synonyms: | FCHGROUP FCH676554 |
MDL Number.: | MFCD17428246 |
H bond acceptor: | 7 |
H bond donor: | 4 |
Smile: | c1cc(ccc1CNC(=O)c2c[nH]nc2)/C(=N\O)/N |
InChi: | InChI=1S/C12H13N5O2/c13-11(17-19)9-3-1-8(2-4-9)5-14-12(18)10-6-15-16-7-10/h1-4,6-7,19H,5H2,(H2,13,17)(H,14,18)(H,15,16) |
InChiKey: | InChIKey=WTRLTWGGKOQMEL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.