* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH676565 |
| English Synonyms: | FCHGROUP FCH676565 |
| MDL Number.: | MFCD17428257 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | c1c[nH]nc1C(=O)Nc2ncc(s2)/C=C/C(=O)O |
| InChi: | InChI=1S/C10H8N4O3S/c15-8(16)2-1-6-5-11-10(18-6)13-9(17)7-3-4-12-14-7/h1-5H,(H,12,14)(H,15,16)(H,11,13,17)/b2-1+ |
| InChiKey: | InChIKey=SPDUUCXEILQGMX-OWOJBTEDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.