* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH676566 |
| English Synonyms: | FCHGROUP FCH676566 |
| MDL Number.: | MFCD17428258 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | c1cc(nc(c1)NC(=O)c2cc[nH]n2)/C=C/C(=O)O |
| InChi: | InChI=1S/C12H10N4O3/c17-11(18)5-4-8-2-1-3-10(14-8)15-12(19)9-6-7-13-16-9/h1-7H,(H,13,16)(H,17,18)(H,14,15,19)/b5-4+ |
| InChiKey: | InChIKey=SFODWRBQYFCMLE-SNAWJCMRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.