* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PROPYL((1-[5-(1H-PYRAZOL-3-YL)-1,3,4-OXADIAZOL-2-YL]PROPYL))AMINE |
| English Synonyms: | PROPYL((1-[5-(1H-PYRAZOL-3-YL)-1,3,4-OXADIAZOL-2-YL]PROPYL))AMINE |
| MDL Number.: | MFCD17428262 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CCCNC(CC)c1nnc(o1)c2cc[nH]n2 |
| InChi: | InChI=1S/C11H17N5O/c1-3-6-12-8(4-2)10-15-16-11(17-10)9-5-7-13-14-9/h5,7-8,12H,3-4,6H2,1-2H3,(H,13,14) |
| InChiKey: | InChIKey=HJUGLSMGEKJNRI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.