* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH676574 |
| English Synonyms: | FCHGROUP FCH676574 |
| MDL Number.: | MFCD17428265 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1ccc(cc1)C2(CC2)c3nc(on3)C(CO)N |
| InChi: | InChI=1S/C13H15N3O2/c14-10(8-17)11-15-12(16-18-11)13(6-7-13)9-4-2-1-3-5-9/h1-5,10,17H,6-8,14H2 |
| InChiKey: | InChIKey=CSUQFIAFAUEIQV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.