* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH676581 |
English Synonyms: | FCHGROUP FCH676581 |
MDL Number.: | MFCD17428272 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)C2(CCC2)c3nc(on3)CCN |
InChi: | InChI=1S/C14H17N3O/c15-10-7-12-16-13(17-18-12)14(8-4-9-14)11-5-2-1-3-6-11/h1-3,5-6H,4,7-10,15H2 |
InChiKey: | InChIKey=YMKSBGHZYHOUQQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.