* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH676595 |
English Synonyms: | FCHGROUP FCH676595 |
MDL Number.: | MFCD17428284 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)C2(CC2)C(=O)Cc3cc(cs3)Br |
InChi: | InChI=1S/C15H13BrOS/c16-12-8-13(18-10-12)9-14(17)15(6-7-15)11-4-2-1-3-5-11/h1-5,8,10H,6-7,9H2 |
InChiKey: | InChIKey=WOIWUJVJDBZNLA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.