* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH588970 |
| English Synonyms: | FCHGROUP FCH588970 |
| MDL Number.: | MFCD17430243 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1cc(nc(n1)N)[C@@]23C[C@H]4C[C@@H](C2)C[C@H](C4)C3 |
| InChi: | InChI=1S/C15H21N3/c1-9-2-13(18-14(16)17-9)15-6-10-3-11(7-15)5-12(4-10)8-15/h2,10-12H,3-8H2,1H3,(H2,16,17,18)/t10-,11+,12-,15- |
| InChiKey: | InChIKey=QFKSIOBIRKZZII-WUQLGEGHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.