* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH640188 |
English Synonyms: | FCHGROUP FCH640188 |
MDL Number.: | MFCD17430272 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CCC(C)NC1(CCCc2c1ccs2)C(=O)N |
InChi: | InChI=1S/C13H20N2OS/c1-3-9(2)15-13(12(14)16)7-4-5-11-10(13)6-8-17-11/h6,8-9,15H,3-5,7H2,1-2H3,(H2,14,16) |
InChiKey: | InChIKey=ODGDOADINUSIFM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.