* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH656308 |
English Synonyms: | FCHGROUP FCH656308 |
MDL Number.: | MFCD17430275 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | C1[C@H]2C[C@H]3C[C@@H]1C[C@@](C2)(C3)c4[nH]c(nn4)CN |
InChi: | InChI=1S/C13H20N4/c14-7-11-15-12(17-16-11)13-4-8-1-9(5-13)3-10(2-8)6-13/h8-10H,1-7,14H2,(H,15,16,17)/t8-,9+,10-,13- |
InChiKey: | InChIKey=JISFJMRJUKIQEZ-QOAFMVCWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.