* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH671552 |
English Synonyms: | FCHGROUP FCH671552 |
MDL Number.: | MFCD17430279 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1c(ncs1)C(=O)NC2[C@H]3C[C@@H]4C[C@H](C3)C[C@H]2C4 |
InChi: | InChI=1S/C14H18N2OS/c17-14(12-6-18-7-15-12)16-13-10-2-8-1-9(4-10)5-11(13)3-8/h6-11,13H,1-5H2,(H,16,17)/t8-,9+,10-,11+,13? |
InChiKey: | InChIKey=XADTWLKHYBBXCN-CEBISCOSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.