* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IBSCREEN-BB BB_NC-0926 |
English Synonyms: | IBSCREEN-BB BB_NC-0926 |
MDL Number.: | MFCD17430287 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | c1cc2n(c(=O)c1)C[C@H]3C[C@@H]2CN(C3)C(=O)NCC(=O)O |
InChi: | InChI=1S/C14H17N3O4/c18-12-3-1-2-11-10-4-9(7-17(11)12)6-16(8-10)14(21)15-5-13(19)20/h1-3,9-10H,4-8H2,(H,15,21)(H,19,20)/t9-,10+/m0/s1 |
InChiKey: | InChIKey=NFIMAMRWMUEMAT-VHSXEESVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.