* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC503076 |
English Synonyms: | BCH-RESEARCH BC503076 |
MDL Number.: | MFCD17432591 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | C/C(=N/O)/c1ccc(cc1)OCC2CCCO2 |
InChi: | InChI=1S/C13H17NO3/c1-10(14-15)11-4-6-12(7-5-11)17-9-13-3-2-8-16-13/h4-7,13,15H,2-3,8-9H2,1H3/b14-10- |
InChiKey: | InChIKey=BVEIHCMTKQNPOB-UVTDQMKNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.