* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-[4-(2,4,5-TRIMETHYLPHENYL)-1,3-THIAZOL-2-YL]ACETONITRILE |
English Synonyms: | 2-[4-(2,4,5-TRIMETHYLPHENYL)-1,3-THIAZOL-2-YL]ACETONITRILE |
MDL Number.: | MFCD17432823 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | Cc1cc(c(cc1C)c2csc(n2)CC#N)C |
InChi: | InChI=1S/C14H14N2S/c1-9-6-11(3)12(7-10(9)2)13-8-17-14(16-13)4-5-15/h6-8H,4H2,1-3H3 |
InChiKey: | InChIKey=CLRXACXNVRFKFN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.