* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC556804 |
| English Synonyms: | BCH-RESEARCH BC556804 |
| MDL Number.: | MFCD17433860 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | Cc1c(c[nH]n1)CNC(C)Cc2ccc(cc2)F |
| InChi: | InChI=1S/C14H18FN3/c1-10(7-12-3-5-14(15)6-4-12)16-8-13-9-17-18-11(13)2/h3-6,9-10,16H,7-8H2,1-2H3,(H,17,18) |
| InChiKey: | InChIKey=HDDORBWUZCBVKP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.