* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OXAN-4-YL 2-AMINO-5-BROMOBENZOATE |
| English Synonyms: | OXAN-4-YL 2-AMINO-5-BROMOBENZOATE |
| MDL Number.: | MFCD17434392 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1cc(c(cc1Br)C(=O)OC2CCOCC2)N |
| InChi: | InChI=1S/C12H14BrNO3/c13-8-1-2-11(14)10(7-8)12(15)17-9-3-5-16-6-4-9/h1-2,7,9H,3-6,14H2 |
| InChiKey: | InChIKey=DAEFWMIGMZLKBV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.