* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC431577 |
| English Synonyms: | BCH-RESEARCH BC431577 |
| MDL Number.: | MFCD17435500 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | C1CN(CC1CN)C(=O)CC2CCS(=O)(=O)C2 |
| InChi: | InChI=1S/C11H20N2O3S/c12-6-10-1-3-13(7-10)11(14)5-9-2-4-17(15,16)8-9/h9-10H,1-8,12H2 |
| InChiKey: | InChIKey=SUOKYZZYANVGED-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.