* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PHENYL(3-PHENYL-1H-1,2,4-TRIAZOL-5-YL)METHANOL |
English Synonyms: | PHENYL(3-PHENYL-1H-1,2,4-TRIAZOL-5-YL)METHANOL |
MDL Number.: | MFCD17437002 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)c2nc([nH]n2)C(c3ccccc3)O |
InChi: | InChI=1S/C15H13N3O/c19-13(11-7-3-1-4-8-11)15-16-14(17-18-15)12-9-5-2-6-10-12/h1-10,13,19H,(H,16,17,18) |
InChiKey: | InChIKey=ONWZQVWVBCJBHL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.