* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-N-[(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)METHYL]QUINOLINE-5,8-DIAMINE |
| English Synonyms: | 8-N-[(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)METHYL]QUINOLINE-5,8-DIAMINE |
| MDL Number.: | MFCD17439527 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | Cn1cnnc1CNc2ccc(c3c2nccc3)N |
| InChi: | InChI=1S/C13H14N6/c1-19-8-17-18-12(19)7-16-11-5-4-10(14)9-3-2-6-15-13(9)11/h2-6,8,16H,7,14H2,1H3 |
| InChiKey: | InChIKey=PLCFOGWVTHPEFK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.