* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC435791 |
| English Synonyms: | BCH-RESEARCH BC435791 |
| MDL Number.: | MFCD17439656 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | Cn1cnnc1CNS(=O)(=O)CC2CCCCN2 |
| InChi: | InChI=1S/C10H19N5O2S/c1-15-8-12-14-10(15)6-13-18(16,17)7-9-4-2-3-5-11-9/h8-9,11,13H,2-7H2,1H3 |
| InChiKey: | InChIKey=HKJRXPCFCXPNGY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.