* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC435799 |
| English Synonyms: | BCH-RESEARCH BC435799 |
| MDL Number.: | MFCD17439664 |
| H bond acceptor: | 9 |
| H bond donor: | 3 |
| Smile: | Cn1cnnc1CNC(=O)N2CC(C[C@H]2C(=O)O)O |
| InChi: | InChI=1S/C10H15N5O4/c1-14-5-12-13-8(14)3-11-10(19)15-4-6(16)2-7(15)9(17)18/h5-7,16H,2-4H2,1H3,(H,11,19)(H,17,18)/t6?,7-/m0/s1 |
| InChiKey: | InChIKey=AXXSWCOYSAGLRL-MLWJPKLSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.