* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | HEPTYL 2-(3-AMINO-1H-PYRAZOL-1-YL)ACETATE |
| English Synonyms: | HEPTYL 2-(3-AMINO-1H-PYRAZOL-1-YL)ACETATE |
| MDL Number.: | MFCD17441151 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCCCCCCOC(=O)Cn1ccc(n1)N |
| InChi: | InChI=1S/C12H21N3O2/c1-2-3-4-5-6-9-17-12(16)10-15-8-7-11(13)14-15/h7-8H,2-6,9-10H2,1H3,(H2,13,14) |
| InChiKey: | InChIKey=JHCGYSIXMVIFEQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.