* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-AMINO-N-(5-METHYL-1,2-OXAZOL-3-YL)-5-NITROBENZAMIDE |
| English Synonyms: | 2-AMINO-N-(5-METHYL-1,2-OXAZOL-3-YL)-5-NITROBENZAMIDE |
| MDL Number.: | MFCD17446968 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | Cc1cc(no1)NC(=O)c2cc(ccc2N)[N+](=O)[O-] |
| InChi: | InChI=1S/C11H10N4O4/c1-6-4-10(14-19-6)13-11(16)8-5-7(15(17)18)2-3-9(8)12/h2-5H,12H2,1H3,(H,13,14,16) |
| InChiKey: | InChIKey=SFVVLKXZZCODBE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.