* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC446303 |
| English Synonyms: | BCH-RESEARCH BC446303 |
| MDL Number.: | MFCD17447879 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CNc1ccnc(c1)C(=O)NC2CCS(=O)(=O)C2 |
| InChi: | InChI=1S/C11H15N3O3S/c1-12-8-2-4-13-10(6-8)11(15)14-9-3-5-18(16,17)7-9/h2,4,6,9H,3,5,7H2,1H3,(H,12,13)(H,14,15) |
| InChiKey: | InChIKey=YIOIWMPCRSYWCI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.