* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC455434 |
| English Synonyms: | BCH-RESEARCH BC455434 |
| MDL Number.: | MFCD17456885 |
| H bond acceptor: | 6 |
| H bond donor: | 4 |
| Smile: | c1cc(c(cc1C(=O)NCC(=O)N)C(F)(F)F)NN |
| InChi: | InChI=1S/C10H11F3N4O2/c11-10(12,13)6-3-5(1-2-7(6)17-15)9(19)16-4-8(14)18/h1-3,17H,4,15H2,(H2,14,18)(H,16,19) |
| InChiKey: | InChIKey=XGKMIKKRWRVCIS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.