* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-HYDRAZINYL-7-(PROPAN-2-YL)-2H,3H-[1,4]DIOXINO[2,3-G]QUINOLINE |
English Synonyms: | 9-HYDRAZINYL-7-(PROPAN-2-YL)-2H,3H-[1,4]DIOXINO[2,3-G]QUINOLINE |
MDL Number.: | MFCD17458152 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CC(C)c1cc(c2cc3c(cc2n1)OCCO3)NN |
InChi: | InChI=1S/C14H17N3O2/c1-8(2)10-6-12(17-15)9-5-13-14(7-11(9)16-10)19-4-3-18-13/h5-8H,3-4,15H2,1-2H3,(H,16,17) |
InChiKey: | InChIKey=OMKYCPURUNQRLG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.