* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC457654 |
| English Synonyms: | BCH-RESEARCH BC457654 |
| MDL Number.: | MFCD17459085 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCCCCN(C)CC1(CCOC1)CNCC |
| InChi: | InChI=1S/C14H30N2O/c1-4-6-7-9-16(3)12-14(11-15-5-2)8-10-17-13-14/h15H,4-13H2,1-3H3 |
| InChiKey: | InChIKey=UDSYZIYCXRWYSG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.