* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC457655 |
| English Synonyms: | BCH-RESEARCH BC457655 |
| MDL Number.: | MFCD17459086 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCCCCN(C)CC1(CCOC1)CNC(C)(C)C |
| InChi: | InChI=1S/C16H34N2O/c1-6-7-8-10-18(5)13-16(9-11-19-14-16)12-17-15(2,3)4/h17H,6-14H2,1-5H3 |
| InChiKey: | InChIKey=VYINUISKIOVPCP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.