* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC457656 |
| English Synonyms: | BCH-RESEARCH BC457656 |
| MDL Number.: | MFCD17459087 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCCCCN(C)CC(C)(CC)CNC1CC1 |
| InChi: | InChI=1S/C15H32N2/c1-5-7-8-11-17(4)13-15(3,6-2)12-16-14-9-10-14/h14,16H,5-13H2,1-4H3 |
| InChiKey: | InChIKey=FMZBQZRMVOWICB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.