* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC458707 |
| English Synonyms: | BCH-RESEARCH BC458707 |
| MDL Number.: | MFCD17460136 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCC(C)(CN(C)C1CCS(=O)(=O)C1)C(=O)O |
| InChi: | InChI=1S/C11H21NO4S/c1-4-11(2,10(13)14)8-12(3)9-5-6-17(15,16)7-9/h9H,4-8H2,1-3H3,(H,13,14) |
| InChiKey: | InChIKey=RJHNZWZCKCTOLI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.