* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC466288 |
| English Synonyms: | BCH-RESEARCH BC466288 |
| MDL Number.: | MFCD17467622 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CCNC(=O)CCOC(=O)Cn1ccc(n1)N |
| InChi: | InChI=1S/C10H16N4O3/c1-2-12-9(15)4-6-17-10(16)7-14-5-3-8(11)13-14/h3,5H,2,4,6-7H2,1H3,(H2,11,13)(H,12,15) |
| InChiKey: | InChIKey=HIYVRRFENINMID-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.