* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC467396 |
| English Synonyms: | BCH-RESEARCH BC467396 |
| MDL Number.: | MFCD17468692 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | CC(C)Cn1c(c(c(=O)[nH]c1=O)N(C)CC(C)O)N |
| InChi: | InChI=1S/C12H22N4O3/c1-7(2)5-16-10(13)9(11(18)14-12(16)19)15(4)6-8(3)17/h7-8,17H,5-6,13H2,1-4H3,(H,14,18,19) |
| InChiKey: | InChIKey=GNGRCOKICUMUSY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.