* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC467655 |
| English Synonyms: | BCH-RESEARCH BC467655 |
| MDL Number.: | MFCD17468948 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CCNc1c(cccn1)S(=O)(=O)N(C)CC(C)O |
| InChi: | InChI=1S/C11H19N3O3S/c1-4-12-11-10(6-5-7-13-11)18(16,17)14(3)8-9(2)15/h5-7,9,15H,4,8H2,1-3H3,(H,12,13) |
| InChiKey: | InChIKey=HGDUBAUBDLEJLR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.