* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC467656 |
| English Synonyms: | BCH-RESEARCH BC467656 |
| MDL Number.: | MFCD17468949 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CCCNc1ncc(cn1)S(=O)(=O)N(C)CC(C)O |
| InChi: | InChI=1S/C11H20N4O3S/c1-4-5-12-11-13-6-10(7-14-11)19(17,18)15(3)8-9(2)16/h6-7,9,16H,4-5,8H2,1-3H3,(H,12,13,14) |
| InChiKey: | InChIKey=JTMUDTOTDXYXKV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.