* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC467976 |
| English Synonyms: | BCH-RESEARCH BC467976 |
| MDL Number.: | MFCD17469246 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | C1CCc2nn(c(=O)n2CC1)C/C=C/C(=O)O |
| InChi: | InChI=1S/C11H15N3O3/c15-10(16)6-4-8-14-11(17)13-7-3-1-2-5-9(13)12-14/h4,6H,1-3,5,7-8H2,(H,15,16)/b6-4+ |
| InChiKey: | InChIKey=ZRHYKSNFKPEZRR-GQCTYLIASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.