* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC467984 |
| English Synonyms: | BCH-RESEARCH BC467984 |
| MDL Number.: | MFCD17469253 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCN(C/C=C/C(=O)O)c1cccc2c1cccc2 |
| InChi: | InChI=1S/C16H17NO2/c1-2-17(12-6-11-16(18)19)15-10-5-8-13-7-3-4-9-14(13)15/h3-11H,2,12H2,1H3,(H,18,19)/b11-6+ |
| InChiKey: | InChIKey=QLZCQXXSYNTVOY-IZZDOVSWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.