* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-[2-(PIPERIDIN-2-YL)ETHOXY]-7H-PURINE |
English Synonyms: | 6-[2-(PIPERIDIN-2-YL)ETHOXY]-7H-PURINE |
MDL Number.: | MFCD17469593 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1[nH]c2c(n1)ncnc2OCCC3CCCCN3 |
InChi: | InChI=1S/C12H17N5O/c1-2-5-13-9(3-1)4-6-18-12-10-11(15-7-14-10)16-8-17-12/h7-9,13H,1-6H2,(H,14,15,16,17) |
InChiKey: | InChIKey=ANVOVFAXIWIWAJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.