* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC468795 |
| English Synonyms: | BCH-RESEARCH BC468795 |
| MDL Number.: | MFCD17470045 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | c1cc([nH]c1C(=O)N2CCCC(C2)CCO)[N+](=O)[O-] |
| InChi: | InChI=1S/C12H17N3O4/c16-7-5-9-2-1-6-14(8-9)12(17)10-3-4-11(13-10)15(18)19/h3-4,9,13,16H,1-2,5-8H2 |
| InChiKey: | InChIKey=XZQOSIGFCMIAMV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.