* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC469033 |
| English Synonyms: | BCH-RESEARCH BC469033 |
| MDL Number.: | MFCD17470280 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCn1ccnc1CNc2cccc(c2)SC |
| InChi: | InChI=1S/C13H17N3S/c1-3-16-8-7-14-13(16)10-15-11-5-4-6-12(9-11)17-2/h4-9,15H,3,10H2,1-2H3 |
| InChiKey: | InChIKey=DGBSEFFOWABFIK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.