* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-BENZYL-1,4,8-TRIAZASPIRO[5.5]UNDECAN-5-ONE |
| English Synonyms: | 8-BENZYL-1,4,8-TRIAZASPIRO[5.5]UNDECAN-5-ONE |
| MDL Number.: | MFCD17470480 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1ccc(cc1)CN2CCCC3(C2)C(=O)NCCN3 |
| InChi: | InChI=1S/C15H21N3O/c19-14-15(17-9-8-16-14)7-4-10-18(12-15)11-13-5-2-1-3-6-13/h1-3,5-6,17H,4,7-12H2,(H,16,19) |
| InChiKey: | InChIKey=LCBJUJSLVHVBTK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.