* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC472430 |
| English Synonyms: | BCH-RESEARCH BC472430 |
| MDL Number.: | MFCD17472903 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | c1ccc(cc1)OCCCn2c(nnc2S)C3CC3 |
| InChi: | InChI=1S/C14H17N3OS/c19-14-16-15-13(11-7-8-11)17(14)9-4-10-18-12-5-2-1-3-6-12/h1-3,5-6,11H,4,7-10H2,(H,16,19) |
| InChiKey: | InChIKey=PUKOGUJSKSXQNL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.