* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-(BUT-3-EN-2-YLOXY)-2,2-DIMETHYL-3,4-DIHYDRO-2H-1-BENZOPYRAN-4-AMINE |
| English Synonyms: | 7-(BUT-3-EN-2-YLOXY)-2,2-DIMETHYL-3,4-DIHYDRO-2H-1-BENZOPYRAN-4-AMINE |
| MDL Number.: | MFCD17473999 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(C=C)Oc1ccc2c(c1)OC(CC2N)(C)C |
| InChi: | InChI=1S/C15H21NO2/c1-5-10(2)17-11-6-7-12-13(16)9-15(3,4)18-14(12)8-11/h5-8,10,13H,1,9,16H2,2-4H3 |
| InChiKey: | InChIKey=DWLSRUPRHYMYIG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.