* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC473873 |
| English Synonyms: | BCH-RESEARCH BC473873 |
| MDL Number.: | MFCD17474312 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1c(csc1COCC2CCOCC2)/C=C/C(=O)O |
| InChi: | InChI=1S/C14H18O4S/c15-14(16)2-1-12-7-13(19-10-12)9-18-8-11-3-5-17-6-4-11/h1-2,7,10-11H,3-6,8-9H2,(H,15,16)/b2-1+ |
| InChiKey: | InChIKey=ULSFPUKROQKBOF-OWOJBTEDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.