* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-[4-(2-CHLOROETHYL)-1H-1,2,3-TRIAZOL-1-YL]QUINOLINE |
| English Synonyms: | 8-[4-(2-CHLOROETHYL)-1H-1,2,3-TRIAZOL-1-YL]QUINOLINE |
| MDL Number.: | MFCD17475662 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | c1cc2cccnc2c(c1)n3cc(nn3)CCCl |
| InChi: | InChI=1S/C13H11ClN4/c14-7-6-11-9-18(17-16-11)12-5-1-3-10-4-2-8-15-13(10)12/h1-5,8-9H,6-7H2 |
| InChiKey: | InChIKey=KQZHIGLLTFDQKD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.