* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-([4-(2-BROMOETHYL)-1H-1,2,3-TRIAZOL-1-YL]METHYL)QUINOLINE |
English Synonyms: | 6-([4-(2-BROMOETHYL)-1H-1,2,3-TRIAZOL-1-YL]METHYL)QUINOLINE |
MDL Number.: | MFCD17475802 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | c1cc2cc(ccc2nc1)Cn3cc(nn3)CCBr |
InChi: | InChI=1S/C14H13BrN4/c15-6-5-13-10-19(18-17-13)9-11-3-4-14-12(8-11)2-1-7-16-14/h1-4,7-8,10H,5-6,9H2 |
InChiKey: | InChIKey=GAGHWSAETAIKAD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.