* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PROPYL(4-(4H,5H,6H,7H-THIENO[3,2-C]PYRIDIN-5-YL)BUTYL)AMINE |
English Synonyms: | PROPYL(4-(4H,5H,6H,7H-THIENO[3,2-C]PYRIDIN-5-YL)BUTYL)AMINE |
MDL Number.: | MFCD17478287 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCNCCCCN1CCc2c(ccs2)C1 |
InChi: | InChI=1S/C14H24N2S/c1-2-7-15-8-3-4-9-16-10-5-14-13(12-16)6-11-17-14/h6,11,15H,2-5,7-10,12H2,1H3 |
InChiKey: | InChIKey=OWDTYMIVLNTKSD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.