* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PROPYL(5-(4H,5H,6H,7H-THIENO[3,2-C]PYRIDIN-5-YL)PENTYL)AMINE |
English Synonyms: | PROPYL(5-(4H,5H,6H,7H-THIENO[3,2-C]PYRIDIN-5-YL)PENTYL)AMINE |
MDL Number.: | MFCD17478298 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCNCCCCCN1CCc2c(ccs2)C1 |
InChi: | InChI=1S/C15H26N2S/c1-2-8-16-9-4-3-5-10-17-11-6-15-14(13-17)7-12-18-15/h7,12,16H,2-6,8-11,13H2,1H3 |
InChiKey: | InChIKey=XWQCGXMKTTXHNE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.