* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-(AZETIDIN-3-YL)-1H-INDOLE |
| English Synonyms: | 7-(AZETIDIN-3-YL)-1H-INDOLE |
| MDL Number.: | MFCD17480590 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | c1cc2cc[nH]c2c(c1)C3CNC3 |
| InChi: | InChI=1S/C11H12N2/c1-2-8-4-5-13-11(8)10(3-1)9-6-12-7-9/h1-5,9,12-13H,6-7H2 |
| InChiKey: | InChIKey=PLMSTTWHSHJAMG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.