* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-(AZETIDIN-3-YL)-1-METHYL-1,2,3,4-TETRAHYDROQUINOLINE |
| English Synonyms: | 6-(AZETIDIN-3-YL)-1-METHYL-1,2,3,4-TETRAHYDROQUINOLINE |
| MDL Number.: | MFCD17480640 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CN1CCCc2c1ccc(c2)C3CNC3 |
| InChi: | InChI=1S/C13H18N2/c1-15-6-2-3-11-7-10(4-5-13(11)15)12-8-14-9-12/h4-5,7,12,14H,2-3,6,8-9H2,1H3 |
| InChiKey: | InChIKey=OXTDCGWBLBVTOO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.